C13H24NO3+ — CID 87120839
2-carboxypropan-2-yl-(2,4-dimethyl-3-oxopent-4-enyl)-dimethylazanium (PubChem CID 87120839) has the molecular formula C13H24NO3+ and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-carboxypropan-2-yl-(2,4-dimethyl-3-oxopent-4-enyl)-dimethylazanium.
| Compound Name | 2-carboxypropan-2-yl-(2,4-dimethyl-3-oxopent-4-enyl)-dimethylazanium |
|---|---|
| PubChem CID | 87120839 |
| Molecular Formula | C13H24NO3+ |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-carboxypropan-2-yl-(2,4-dimethyl-3-oxopent-4-enyl)-dimethylazanium |
| SMILES | C=C(C)C(=O)C(C)C[N+](C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H23NO3/c1-9(2)11(15)10(3)8-14(6,7)13(4,5)12(16)17/h10H,1,8H2,2-7H3/p+1 |
| InChIKey | XJHHZLZQDZFJET-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|