C28H27F6N7O7 — CID 175459494
1,3-dimethoxy-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea;5,5-dimethyl-2-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-1,2-oxazolidin-3-one (PubChem CID 175459494) has the molecular formula C28H27F6N7O7 and a molecular weight of 687.55 g/mol. Its IUPAC name is 1,3-dimethoxy-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea;5,5-dimethyl-2-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-1,2-oxazolidin-3-one.
| Compound Name | 1,3-dimethoxy-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea;5,5-dimethyl-2-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 175459494 |
| Molecular Formula | C28H27F6N7O7 |
| Molecular Weight | 687.55 g/mol |
| Exact Mass | 687.19 |
| IUPAC Name | 1,3-dimethoxy-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea;5,5-dimethyl-2-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-1,2-oxazolidin-3-one |
| SMILES | CC1(C)CC(=O)N(Cc2ccc(-c3noc(C(F)(F)F)n3)cc2)O1.CONC(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C15H14F3N3O3.C13H13F3N4O4/c1-14(2)7-11(22)21(24-14)8-9-3-5-10(6-4-9)12-19-13(23-20-12)15(16,17)18;1-22-19-12(21)20(23-2)7-8-3-5-9(6-4-8)10-17-11(24-18-10)13(14,15)16/h3-6H,7-8H2,1-2H3;3-6H,7H2,1-2H3,(H,19,21) |
| InChIKey | OZXOQJFXGSKFPO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|