About [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate
[2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate (PubChem CID 175464902) has the molecular formula C17H13F3N2O3
and a molecular weight of 350.30 g/mol. Its IUPAC name is [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate.
Molecular Properties
| Compound Name | [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate |
| PubChem CID | 175464902 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate |
| SMILES | NC(=O)OC1Cc2ccccc2N(c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H13F3N2O3/c18-17(19,20)11-5-7-12(8-6-11)22-13-4-2-1-3-10(13)9-14(15(22)23)25-16(21)24/h1-8,14H,9H2,(H2,21,24) |
| InChIKey | ITFFGBLQCKJDAB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate?
The IUPAC name of [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate (CID 175464902) is [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate.
What is the SMILES notation for [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate?
The canonical SMILES for [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate is NC(=O)OC1Cc2ccccc2N(c2ccc(C(F)(F)F)cc2)C1=O.
What is the InChIKey of [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate?
The InChIKey is ITFFGBLQCKJDAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2O3/c18-17(19,20)11-5-7-12(8-6-11)22-13-4-2-1-3-10(13)9-14(15(22)23)25-16(21)24/h1-8,14H,9H2,(H2,21,24).
What are the key properties of [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate?
[2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate has a molecular weight of 350.30 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-1-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-3-yl] carbamate is sourced from PubChem (CID 175464902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).