C9H15BN2O4 — CID 175483034
[4-(5-carbamoyl-1,3-oxazol-2-yl)-3-methylbutyl]boronic acid (PubChem CID 175483034) has the molecular formula C9H15BN2O4 and a molecular weight of 226.04 g/mol. Its IUPAC name is [4-(5-carbamoyl-1,3-oxazol-2-yl)-3-methylbutyl]boronic acid.
| Compound Name | [4-(5-carbamoyl-1,3-oxazol-2-yl)-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 175483034 |
| Molecular Formula | C9H15BN2O4 |
| Molecular Weight | 226.04 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [4-(5-carbamoyl-1,3-oxazol-2-yl)-3-methylbutyl]boronic acid |
| SMILES | CC(CCB(O)O)Cc1ncc(C(N)=O)o1 |
| InChI | InChI=1S/C9H15BN2O4/c1-6(2-3-10(14)15)4-8-12-5-7(16-8)9(11)13/h5-6,14-15H,2-4H2,1H3,(H2,11,13) |
| InChIKey | VCEFCCUAVKHWPD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.04 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|