About sodium;arsoric acid;acetate
sodium;arsoric acid;acetate (PubChem CID 175509345) has the molecular formula C2H6AsNaO6
and a molecular weight of 223.98 g/mol. Its IUPAC name is sodium;arsoric acid;acetate.
Molecular Properties
| Compound Name | sodium;arsoric acid;acetate |
| PubChem CID | 175509345 |
| Molecular Formula | C2H6AsNaO6 |
| Molecular Weight | 223.98 g/mol |
| Exact Mass | 223.93 |
| IUPAC Name | sodium;arsoric acid;acetate |
| SMILES | CC(=O)[O-].O=[As](O)(O)O.[Na+] |
| InChI | InChI=1S/C2H4O2.AsH3O4.Na/c1-2(3)4;2-1(3,4)5;/h1H3,(H,3,4);(H3,2,3,4,5);/q;;+1/p-1 |
| InChIKey | UFVWUAOQZZPENW-UHFFFAOYSA-M |
| XLogP | -6.41 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.98 |
| LogP ≤ 5 | -6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;arsoric acid;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;arsoric acid;acetate?
The IUPAC name of sodium;arsoric acid;acetate (CID 175509345) is sodium;arsoric acid;acetate.
What is the SMILES notation for sodium;arsoric acid;acetate?
The canonical SMILES for sodium;arsoric acid;acetate is CC(=O)[O-].O=[As](O)(O)O.[Na+].
What is the InChIKey of sodium;arsoric acid;acetate?
The InChIKey is UFVWUAOQZZPENW-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.AsH3O4.Na/c1-2(3)4;2-1(3,4)5;/h1H3,(H,3,4);(H3,2,3,4,5);/q;;+1/p-1.
What are the key properties of sodium;arsoric acid;acetate?
sodium;arsoric acid;acetate has a molecular weight of 223.98 g/mol, XLogP of -6.41, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;arsoric acid;acetate is sourced from PubChem (CID 175509345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).