C15H22O — CID 175510326
(4-methoxy-2,4-dimethylcyclohexyl)benzene (PubChem CID 175510326) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (4-methoxy-2,4-dimethylcyclohexyl)benzene.
| Compound Name | (4-methoxy-2,4-dimethylcyclohexyl)benzene |
|---|---|
| PubChem CID | 175510326 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (4-methoxy-2,4-dimethylcyclohexyl)benzene |
| SMILES | COC1(C)CCC(c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C15H22O/c1-12-11-15(2,16-3)10-9-14(12)13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3 |
| InChIKey | ZAMQFMUWZZXFOJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |