About magnesium;dipyridin-2-ylmethanethione;sulfate
magnesium;dipyridin-2-ylmethanethione;sulfate (PubChem CID 175513752) has the molecular formula C11H8MgN2O4S2
and a molecular weight of 320.63 g/mol. Its IUPAC name is magnesium;dipyridin-2-ylmethanethione;sulfate.
Molecular Properties
| Compound Name | magnesium;dipyridin-2-ylmethanethione;sulfate |
| PubChem CID | 175513752 |
| Molecular Formula | C11H8MgN2O4S2 |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | magnesium;dipyridin-2-ylmethanethione;sulfate |
| SMILES | O=S(=O)([O-])[O-].S=C(c1ccccn1)c1ccccn1.[Mg+2] |
| InChI | InChI=1S/C11H8N2S.Mg.H2O4S/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10;;1-5(2,3)4/h1-8H;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | UPRAZTSMLUZFGZ-UHFFFAOYSA-L |
| XLogP | 0.52 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze magnesium;dipyridin-2-ylmethanethione;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;dipyridin-2-ylmethanethione;sulfate?
The IUPAC name of magnesium;dipyridin-2-ylmethanethione;sulfate (CID 175513752) is magnesium;dipyridin-2-ylmethanethione;sulfate.
What is the SMILES notation for magnesium;dipyridin-2-ylmethanethione;sulfate?
The canonical SMILES for magnesium;dipyridin-2-ylmethanethione;sulfate is O=S(=O)([O-])[O-].S=C(c1ccccn1)c1ccccn1.[Mg+2].
What is the InChIKey of magnesium;dipyridin-2-ylmethanethione;sulfate?
The InChIKey is UPRAZTSMLUZFGZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H8N2S.Mg.H2O4S/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10;;1-5(2,3)4/h1-8H;;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of magnesium;dipyridin-2-ylmethanethione;sulfate?
magnesium;dipyridin-2-ylmethanethione;sulfate has a molecular weight of 320.63 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;dipyridin-2-ylmethanethione;sulfate is sourced from PubChem (CID 175513752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).