C15H16Cl2N4O5S — CID 175516689
2-hydroxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate (PubChem CID 175516689) has the molecular formula C15H16Cl2N4O5S and a molecular weight of 435.29 g/mol. Its IUPAC name is 2-hydroxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate.
| Compound Name | 2-hydroxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate |
|---|---|
| PubChem CID | 175516689 |
| Molecular Formula | C15H16Cl2N4O5S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 2-hydroxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate |
| SMILES | CC(COC(=O)c1cc(N2C(=O)N(C)C(S)N(C)C2=O)c(Cl)cc1Cl)=NO |
| InChI | InChI=1S/C15H16Cl2N4O5S/c1-7(18-25)6-26-12(22)8-4-11(10(17)5-9(8)16)21-13(23)19(2)15(27)20(3)14(21)24/h4-5,15,25,27H,6H2,1-3H3 |
| InChIKey | SOAKWNMHDOPPAG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|