C12H14N2O6 — CID 175522793
5-amino-2-hydroxybenzoic acid;2-(prop-2-enoylamino)acetic acid (PubChem CID 175522793) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-amino-2-hydroxybenzoic acid;2-(prop-2-enoylamino)acetic acid.
| Compound Name | 5-amino-2-hydroxybenzoic acid;2-(prop-2-enoylamino)acetic acid |
|---|---|
| PubChem CID | 175522793 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-amino-2-hydroxybenzoic acid;2-(prop-2-enoylamino)acetic acid |
| SMILES | C=CC(=O)NCC(=O)O.Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO3.C5H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11;1-2-4(7)6-3-5(8)9/h1-3,9H,8H2,(H,10,11);2H,1,3H2,(H,6,7)(H,8,9) |
| InChIKey | PAEMTIGTAIMPGW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|