C23H44N4O7 — CID 175532027
tert-butyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(4-oxo-4-piperazin-1-ylbutyl)amino]acetate;formic acid (PubChem CID 175532027) has the molecular formula C23H44N4O7 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(4-oxo-4-piperazin-1-ylbutyl)amino]acetate;formic acid.
| Compound Name | tert-butyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(4-oxo-4-piperazin-1-ylbutyl)amino]acetate;formic acid |
|---|---|
| PubChem CID | 175532027 |
| Molecular Formula | C23H44N4O7 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | tert-butyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(4-oxo-4-piperazin-1-ylbutyl)amino]acetate;formic acid |
| SMILES | CC(C)(C)OC(=O)CN(CCCNC(=O)OC(C)(C)C)CCCC(=O)N1CCNCC1.O=CO |
| InChI | InChI=1S/C22H42N4O5.CH2O2/c1-21(2,3)30-19(28)17-25(14-8-10-24-20(29)31-22(4,5)6)13-7-9-18(27)26-15-11-23-12-16-26;2-1-3/h23H,7-17H2,1-6H3,(H,24,29);1H,(H,2,3) |
| InChIKey | VIXXAWFYHDYBEN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|