C17H26N2O4 — CID 175536063
[1-(carboxyamino)-6,6-dimethyl-5-phenylheptan-3-yl]carbamic acid (PubChem CID 175536063) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is [1-(carboxyamino)-6,6-dimethyl-5-phenylheptan-3-yl]carbamic acid.
| Compound Name | [1-(carboxyamino)-6,6-dimethyl-5-phenylheptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 175536063 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [1-(carboxyamino)-6,6-dimethyl-5-phenylheptan-3-yl]carbamic acid |
| SMILES | CC(C)(C)C(CC(CCNC(=O)O)NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)14(12-7-5-4-6-8-12)11-13(19-16(22)23)9-10-18-15(20)21/h4-8,13-14,18-19H,9-11H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | XLMKXBQJHNACGP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |