C22H41N3O — CID 175545229
1,3,5-triamino-2,4,6-tripentylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 175545229) has the molecular formula C22H41N3O and a molecular weight of 363.59 g/mol. Its IUPAC name is 1,3,5-triamino-2,4,6-tripentylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1,3,5-triamino-2,4,6-tripentylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 175545229 |
| Molecular Formula | C22H41N3O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.32 |
| IUPAC Name | 1,3,5-triamino-2,4,6-tripentylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCCCCC1=C(N)C(CCCCC)C(N)(C=O)C(CCCCC)=C1N |
| InChI | InChI=1S/C22H41N3O/c1-4-7-10-13-17-20(23)18(14-11-8-5-2)22(25,16-26)19(21(17)24)15-12-9-6-3/h16,18H,4-15,23-25H2,1-3H3 |
| InChIKey | OTCJOIQDSOZJRU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|