About 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one
9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one (PubChem CID 175548586) has the molecular formula C27H21N5O
and a molecular weight of 431.50 g/mol. Its IUPAC name is 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one.
Molecular Properties
| Compound Name | 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one |
| PubChem CID | 175548586 |
| Molecular Formula | C27H21N5O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one |
| SMILES | CC=Cn1ccc2ccc(-n3c(=O)ccc4cnc5ccc(-c6cnn(C)c6)cc5c43)cc21 |
| InChI | InChI=1S/C27H21N5O/c1-3-11-31-12-10-18-4-7-22(14-25(18)31)32-26(33)9-6-20-15-28-24-8-5-19(13-23(24)27(20)32)21-16-29-30(2)17-21/h3-17H,1-2H3 |
| InChIKey | GPAJNCDMOBHGHQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one?
The IUPAC name of 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one (CID 175548586) is 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one.
What is the SMILES notation for 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one?
The canonical SMILES for 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one is CC=Cn1ccc2ccc(-n3c(=O)ccc4cnc5ccc(-c6cnn(C)c6)cc5c43)cc21.
What is the InChIKey of 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one?
The InChIKey is GPAJNCDMOBHGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21N5O/c1-3-11-31-12-10-18-4-7-22(14-25(18)31)32-26(33)9-6-20-15-28-24-8-5-19(13-23(24)27(20)32)21-16-29-30(2)17-21/h3-17H,1-2H3.
What are the key properties of 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one?
9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one has a molecular weight of 431.50 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1-methylpyrazol-4-yl)-1-(1-prop-1-enylindol-6-yl)benzo[h][1,6]naphthyridin-2-one is sourced from PubChem (CID 175548586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).