C40H52N6O2 — CID 175550101
N'-[2-amino-3-(1-tritylimidazol-4-yl)propanoyl]-6-(non-1-en-2-ylamino)hexanehydrazide (PubChem CID 175550101) has the molecular formula C40H52N6O2 and a molecular weight of 648.90 g/mol. Its IUPAC name is N'-[2-amino-3-(1-tritylimidazol-4-yl)propanoyl]-6-(non-1-en-2-ylamino)hexanehydrazide.
| Compound Name | N'-[2-amino-3-(1-tritylimidazol-4-yl)propanoyl]-6-(non-1-en-2-ylamino)hexanehydrazide |
|---|---|
| PubChem CID | 175550101 |
| Molecular Formula | C40H52N6O2 |
| Molecular Weight | 648.90 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | N'-[2-amino-3-(1-tritylimidazol-4-yl)propanoyl]-6-(non-1-en-2-ylamino)hexanehydrazide |
| SMILES | C=C(CCCCCCC)NCCCCCC(=O)NNC(=O)C(N)Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C40H52N6O2/c1-3-4-5-6-11-20-32(2)42-28-19-10-18-27-38(47)44-45-39(48)37(41)29-36-30-46(31-43-36)40(33-21-12-7-13-22-33,34-23-14-8-15-24-34)35-25-16-9-17-26-35/h7-9,12-17,21-26,30-31,37,42H,2-6,10-11,18-20,27-29,41H2,1H3,(H,44,47)(H,45,48) |
| InChIKey | XNVWFAFZQLAJKV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.90 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|