C23H26N2O4 — CID 175552505
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenyl-1H-indol-3-yl] butanoate (PubChem CID 175552505) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenyl-1H-indol-3-yl] butanoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenyl-1H-indol-3-yl] butanoate |
|---|---|
| PubChem CID | 175552505 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenyl-1H-indol-3-yl] butanoate |
| SMILES | CCCC(=O)Oc1c(NC(=O)OC(C)(C)C)[nH]c2c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C23H26N2O4/c1-5-10-18(26)28-20-17-14-9-13-16(15-11-7-6-8-12-15)19(17)24-21(20)25-22(27)29-23(2,3)4/h6-9,11-14,24H,5,10H2,1-4H3,(H,25,27) |
| InChIKey | QPSDJECQZBWOOQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |