C6H6N8O8 — CID 175553234
2,7-diamino-3,6-dinitro-4H-pyrazolo[1,5-a]pyrimidin-5-one;nitric acid (PubChem CID 175553234) has the molecular formula C6H6N8O8 and a molecular weight of 318.16 g/mol. Its IUPAC name is 2,7-diamino-3,6-dinitro-4H-pyrazolo[1,5-a]pyrimidin-5-one;nitric acid.
| Compound Name | 2,7-diamino-3,6-dinitro-4H-pyrazolo[1,5-a]pyrimidin-5-one;nitric acid |
|---|---|
| PubChem CID | 175553234 |
| Molecular Formula | C6H6N8O8 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2,7-diamino-3,6-dinitro-4H-pyrazolo[1,5-a]pyrimidin-5-one;nitric acid |
| SMILES | Nc1nn2c(N)c([N+](=O)[O-])c(=O)[nH]c2c1[N+](=O)[O-].O=[N+]([O-])O |
| InChI | InChI=1S/C6H5N7O5.HNO3/c7-3-1(12(15)16)5-9-6(14)2(13(17)18)4(8)11(5)10-3;2-1(3)4/h8H2,(H2,7,10)(H,9,14);(H,2,3,4) |
| InChIKey | PWIILIQIQFVDJO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 251.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|