About (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol
(E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol (PubChem CID 175554426) has the molecular formula C20H39ClO
and a molecular weight of 330.98 g/mol. Its IUPAC name is (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol |
| PubChem CID | 175554426 |
| Molecular Formula | C20H39ClO |
| Molecular Weight | 330.98 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol |
| SMILES | CCCC(C)CCCC(C)CCC(/C=C(/Cl)C(C)O)C(C)C |
| InChI | InChI=1S/C20H39ClO/c1-7-9-16(4)10-8-11-17(5)12-13-19(15(2)3)14-20(21)18(6)22/h14-19,22H,7-13H2,1-6H3/b20-14+ |
| InChIKey | WNWOUSJRBRFNDS-XSFVSMFZSA-N |
| XLogP | 6.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.98 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol?
The IUPAC name of (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol (CID 175554426) is (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol.
What is the SMILES notation for (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol?
The canonical SMILES for (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol is CCCC(C)CCCC(C)CCC(/C=C(/Cl)C(C)O)C(C)C.
What is the InChIKey of (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol?
The InChIKey is WNWOUSJRBRFNDS-XSFVSMFZSA-N. The full InChI is InChI=1S/C20H39ClO/c1-7-9-16(4)10-8-11-17(5)12-13-19(15(2)3)14-20(21)18(6)22/h14-19,22H,7-13H2,1-6H3/b20-14+.
What are the key properties of (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol?
(E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol has a molecular weight of 330.98 g/mol, XLogP of 6.78, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-chloro-8,12-dimethyl-5-propan-2-ylpentadec-3-en-2-ol is sourced from PubChem (CID 175554426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).