C10H24O4 — CID 175563606
butane-1,4-diol;4-methylpentane-1,1-diol (PubChem CID 175563606) has the molecular formula C10H24O4 and a molecular weight of 208.30 g/mol. Its IUPAC name is butane-1,4-diol;4-methylpentane-1,1-diol.
| Compound Name | butane-1,4-diol;4-methylpentane-1,1-diol |
|---|---|
| PubChem CID | 175563606 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | butane-1,4-diol;4-methylpentane-1,1-diol |
| SMILES | CC(C)CCC(O)O.OCCCCO |
| InChI | InChI=1S/C6H14O2.C4H10O2/c1-5(2)3-4-6(7)8;5-3-1-2-4-6/h5-8H,3-4H2,1-2H3;5-6H,1-4H2 |
| InChIKey | YMIOOOZCBUTJGF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|