C12H18O9 — CID 175569272
3,4-dimethylfuran-2,5-dione;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175569272) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is 3,4-dimethylfuran-2,5-dione;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 3,4-dimethylfuran-2,5-dione;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175569272 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3,4-dimethylfuran-2,5-dione;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC1=C(C)C(=O)OC1=O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C6H6O3/c7-1-3(9)5(11)6(12)4(10)2-8;1-3-4(2)6(8)9-5(3)7/h1,3-6,8-12H,2H2;1-2H3 |
| InChIKey | IAJSTJXKFWEFIN-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|