C19H17ClF4N2O4 — CID 175606056
[3-[[4-chloro-3-(trifluoromethoxy)benzoyl]amino]-4-fluoroanilino] 2,2-dimethylpropanoate (PubChem CID 175606056) has the molecular formula C19H17ClF4N2O4 and a molecular weight of 448.80 g/mol. Its IUPAC name is [3-[[4-chloro-3-(trifluoromethoxy)benzoyl]amino]-4-fluoroanilino] 2,2-dimethylpropanoate.
| Compound Name | [3-[[4-chloro-3-(trifluoromethoxy)benzoyl]amino]-4-fluoroanilino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175606056 |
| Molecular Formula | C19H17ClF4N2O4 |
| Molecular Weight | 448.80 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | [3-[[4-chloro-3-(trifluoromethoxy)benzoyl]amino]-4-fluoroanilino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONc1ccc(F)c(NC(=O)c2ccc(Cl)c(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H17ClF4N2O4/c1-18(2,3)17(28)30-26-11-5-7-13(21)14(9-11)25-16(27)10-4-6-12(20)15(8-10)29-19(22,23)24/h4-9,26H,1-3H3,(H,25,27) |
| InChIKey | YGEIDZVCUZCKOE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.80 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|