C22H44N2O4 — CID 175617289
3-methylpentyl 8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]octanoate (PubChem CID 175617289) has the molecular formula C22H44N2O4 and a molecular weight of 400.60 g/mol. Its IUPAC name is 3-methylpentyl 8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]octanoate.
| Compound Name | 3-methylpentyl 8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]octanoate |
|---|---|
| PubChem CID | 175617289 |
| Molecular Formula | C22H44N2O4 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 3-methylpentyl 8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]octanoate |
| SMILES | CCC(C)CCOC(=O)CCCCCCCNCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H44N2O4/c1-6-19(2)14-18-27-20(25)13-10-8-7-9-11-15-23-16-12-17-24-21(26)28-22(3,4)5/h19,23H,6-18H2,1-5H3,(H,24,26) |
| InChIKey | FOGKAKBXOACCPP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|