C31H34F3N3O5S — CID 175624780
N-[(3S)-4'-benzyl-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,8'-3,4,7,9-tetrahydro-2H-pyrido[4,3-b]azepine]-5'-yl]-2-methylsulfonylacetamide (PubChem CID 175624780) has the molecular formula C31H34F3N3O5S and a molecular weight of 617.69 g/mol. Its IUPAC name is N-[(3S)-4'-benzyl-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,8'-3,4,7,9-tetrahydro-2H-pyrido[4,3-b]azepine]-5'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3S)-4'-benzyl-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,8'-3,4,7,9-tetrahydro-2H-pyrido[4,3-b]azepine]-5'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 175624780 |
| Molecular Formula | C31H34F3N3O5S |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | N-[(3S)-4'-benzyl-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,8'-3,4,7,9-tetrahydro-2H-pyrido[4,3-b]azepine]-5'-yl]-2-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)CC(=O)NC1=C2C(=O)N[C@@]3(CCc4cc(OCCCC(F)(F)F)ccc43)CC2=NCCC1Cc1ccccc1 |
| InChI | InChI=1S/C31H34F3N3O5S/c1-43(40,41)19-26(38)36-28-22(16-20-6-3-2-4-7-20)11-14-35-25-18-30(37-29(39)27(25)28)13-10-21-17-23(8-9-24(21)30)42-15-5-12-31(32,33)34/h2-4,6-9,17,22H,5,10-16,18-19H2,1H3,(H,36,38)(H,37,39)/t22?,30-/m0/s1 |
| InChIKey | VWLBWWPHZPACIP-YBJSGSKQSA-N |
| XLogP | 4.19 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|