C25H22F3N3O3 — CID 145298860
4-[5'-cyano-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-4'-yl]benzamide (PubChem CID 145298860) has the molecular formula C25H22F3N3O3 and a molecular weight of 469.46 g/mol. Its IUPAC name is 4-[5'-cyano-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-4'-yl]benzamide.
| Compound Name | 4-[5'-cyano-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-4'-yl]benzamide |
|---|---|
| PubChem CID | 145298860 |
| Molecular Formula | C25H22F3N3O3 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 4-[5'-cyano-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-4'-yl]benzamide |
| SMILES | N#CC1=C(c2ccc(C(N)=O)cc2)CC2(CCc3cc(OCCCC(F)(F)F)ccc32)NC1=O |
| InChI | InChI=1S/C25H22F3N3O3/c26-25(27,28)9-1-11-34-18-6-7-21-17(12-18)8-10-24(21)13-19(20(14-29)23(33)31-24)15-2-4-16(5-3-15)22(30)32/h2-7,12H,1,8-11,13H2,(H2,30,32)(H,31,33) |
| InChIKey | NIAXQVJLSZDCSQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|