C29H31F3N2O2 — CID 145298862
6'-oxo-4'-(4-pentylphenyl)-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile (PubChem CID 145298862) has the molecular formula C29H31F3N2O2 and a molecular weight of 496.57 g/mol. Its IUPAC name is 6'-oxo-4'-(4-pentylphenyl)-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile.
| Compound Name | 6'-oxo-4'-(4-pentylphenyl)-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile |
|---|---|
| PubChem CID | 145298862 |
| Molecular Formula | C29H31F3N2O2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 6'-oxo-4'-(4-pentylphenyl)-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile |
| SMILES | CCCCCc1ccc(C2=C(C#N)C(=O)NC3(CCc4cc(OCCCC(F)(F)F)ccc43)C2)cc1 |
| InChI | InChI=1S/C29H31F3N2O2/c1-2-3-4-6-20-7-9-21(10-8-20)24-18-28(34-27(35)25(24)19-33)15-13-22-17-23(11-12-26(22)28)36-16-5-14-29(30,31)32/h7-12,17H,2-6,13-16,18H2,1H3,(H,34,35) |
| InChIKey | JHLJLIPUMGMWDW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|