C14H15ClN6O6 — CID 175624791
6-chloro-4-[3-(N'-hydroxycarbamimidoyl)-2-methoxyanilino]-N-(trihydroxymethyl)pyridazine-3-carboxamide (PubChem CID 175624791) has the molecular formula C14H15ClN6O6 and a molecular weight of 398.76 g/mol. Its IUPAC name is 6-chloro-4-[3-(N'-hydroxycarbamimidoyl)-2-methoxyanilino]-N-(trihydroxymethyl)pyridazine-3-carboxamide.
| Compound Name | 6-chloro-4-[3-(N'-hydroxycarbamimidoyl)-2-methoxyanilino]-N-(trihydroxymethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175624791 |
| Molecular Formula | C14H15ClN6O6 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 6-chloro-4-[3-(N'-hydroxycarbamimidoyl)-2-methoxyanilino]-N-(trihydroxymethyl)pyridazine-3-carboxamide |
| SMILES | COc1c(Nc2cc(Cl)nnc2C(=O)NC(O)(O)O)cccc1C(N)=NO |
| InChI | InChI=1S/C14H15ClN6O6/c1-27-11-6(12(16)21-26)3-2-4-7(11)17-8-5-9(15)19-20-10(8)13(22)18-14(23,24)25/h2-5,23-26H,1H3,(H2,16,21)(H,17,19)(H,18,22) |
| InChIKey | BXWNPMZVHSBPNR-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 195.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|