C21H24N2O5 — CID 175626457
tert-butyl 4-[3-(4-hydroxy-2-oxochromen-8-yl)prop-2-ynyl]piperazine-1-carboxylate (PubChem CID 175626457) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-hydroxy-2-oxochromen-8-yl)prop-2-ynyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-hydroxy-2-oxochromen-8-yl)prop-2-ynyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175626457 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | tert-butyl 4-[3-(4-hydroxy-2-oxochromen-8-yl)prop-2-ynyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC#Cc2cccc3c(O)cc(=O)oc23)CC1 |
| InChI | InChI=1S/C21H24N2O5/c1-21(2,3)28-20(26)23-12-10-22(11-13-23)9-5-7-15-6-4-8-16-17(24)14-18(25)27-19(15)16/h4,6,8,14,24H,9-13H2,1-3H3 |
| InChIKey | DWBHPNXXXFSWGI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|