C16H23N2O3Y- — CID 59369617
tert-butyl 4-[(2-hydroxybenzene-6-id-1-yl)methyl]piperazine-1-carboxylate;yttrium (PubChem CID 59369617) has the molecular formula C16H23N2O3Y- and a molecular weight of 380.28 g/mol. Its IUPAC name is tert-butyl 4-[(2-hydroxybenzene-6-id-1-yl)methyl]piperazine-1-carboxylate;yttrium.
| Compound Name | tert-butyl 4-[(2-hydroxybenzene-6-id-1-yl)methyl]piperazine-1-carboxylate;yttrium |
|---|---|
| PubChem CID | 59369617 |
| Molecular Formula | C16H23N2O3Y- |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | tert-butyl 4-[(2-hydroxybenzene-6-id-1-yl)methyl]piperazine-1-carboxylate;yttrium |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2[c-]cccc2O)CC1.[Y] |
| InChI | InChI=1S/C16H23N2O3.Y/c1-16(2,3)21-15(20)18-10-8-17(9-11-18)12-13-6-4-5-7-14(13)19;/h4-5,7,19H,8-12H2,1-3H3;/q-1; |
| InChIKey | IAVZOQVCFNNGDB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|