C18H24FN4O4+ — CID 175630913
(2E)-2-[(3E)-1-(2,6-dioxopiperidin-3-yl)-3-(2-fluoroethylidene)-2-oxoazocan-4-ylidene]-2-methoxy-N-(methylamino)acetonitrilium (PubChem CID 175630913) has the molecular formula C18H24FN4O4+ and a molecular weight of 379.41 g/mol. Its IUPAC name is (2E)-2-[(3E)-1-(2,6-dioxopiperidin-3-yl)-3-(2-fluoroethylidene)-2-oxoazocan-4-ylidene]-2-methoxy-N-(methylamino)acetonitrilium.
| Compound Name | (2E)-2-[(3E)-1-(2,6-dioxopiperidin-3-yl)-3-(2-fluoroethylidene)-2-oxoazocan-4-ylidene]-2-methoxy-N-(methylamino)acetonitrilium |
|---|---|
| PubChem CID | 175630913 |
| Molecular Formula | C18H24FN4O4+ |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (2E)-2-[(3E)-1-(2,6-dioxopiperidin-3-yl)-3-(2-fluoroethylidene)-2-oxoazocan-4-ylidene]-2-methoxy-N-(methylamino)acetonitrilium |
| SMILES | CN[N+]#C/C(OC)=C1/CCCCN(C2CCC(=O)NC2=O)C(=O)/C1=C/CF |
| InChI | InChI=1S/C18H23FN4O4/c1-20-21-11-15(27-2)12-5-3-4-10-23(18(26)13(12)8-9-19)14-6-7-16(24)22-17(14)25/h8,14,20H,3-7,9-10H2,1-2H3/p+1/b13-8+,15-12+ |
| InChIKey | GHYZQNSDNPOKDW-MKRNSSSCSA-O |
| XLogP | 1.07 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|