C24H30N2O5 — CID 175647435
2-[(8S,9R)-9-(4-methylpiperazin-1-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 3-methylbut-2-enoate (PubChem CID 175647435) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-[(8S,9R)-9-(4-methylpiperazin-1-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 3-methylbut-2-enoate.
| Compound Name | 2-[(8S,9R)-9-(4-methylpiperazin-1-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 175647435 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-[(8S,9R)-9-(4-methylpiperazin-1-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC(C)(C)[C@H]1Oc2ccc3ccc(=O)oc3c2[C@H]1N1CCN(C)CC1 |
| InChI | InChI=1S/C24H30N2O5/c1-15(2)14-19(28)31-24(3,4)23-21(26-12-10-25(5)11-13-26)20-17(29-23)8-6-16-7-9-18(27)30-22(16)20/h6-9,14,21,23H,10-13H2,1-5H3/t21-,23+/m1/s1 |
| InChIKey | CNWHZYSHUCOFBP-GGAORHGYSA-N |
| XLogP | 3.13 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|