C22H22N4O3 — CID 175655644
N-(6-methyl-2-pyridinyl)-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine (PubChem CID 175655644) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine.
| Compound Name | N-(6-methyl-2-pyridinyl)-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine |
|---|---|
| PubChem CID | 175655644 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine |
| SMILES | Cc1cccc(N/C2=N\CCOCCOc3ccccc3Oc3ncccc32)n1 |
| InChI | InChI=1S/C22H22N4O3/c1-16-6-4-10-20(25-16)26-21-17-7-5-11-24-22(17)29-19-9-3-2-8-18(19)28-15-14-27-13-12-23-21/h2-11H,12-15H2,1H3,(H,23,25,26) |
| InChIKey | MFGBHFIWKQIUOA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |