C36H32N4O2S — CID 175666539
3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 175666539) has the molecular formula C36H32N4O2S and a molecular weight of 584.75 g/mol. Its IUPAC name is 3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | 3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175666539 |
| Molecular Formula | C36H32N4O2S |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCn1c2ccc(C=C(C#N)C(=O)Nc3ccc(OC)cc3)cc2c2cc(-c3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C36H32N4O2S/c1-3-4-5-8-19-40-32-17-11-24(20-26(23-37)35(41)38-27-13-15-28(42-2)16-14-27)21-29(32)30-22-25(12-18-33(30)40)36-39-31-9-6-7-10-34(31)43-36/h6-7,9-18,20-22H,3-5,8,19H2,1-2H3,(H,38,41) |
| InChIKey | BGYZHJKDMXKVEQ-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|