C14H22N6O3S — CID 175676806
(2S,3S,4R,5R)-2-[[3-aminopropyl(methyl)sulfonio]methyl]-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-3-olate (PubChem CID 175676806) has the molecular formula C14H22N6O3S and a molecular weight of 354.44 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[[3-aminopropyl(methyl)sulfonio]methyl]-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-3-olate.
| Compound Name | (2S,3S,4R,5R)-2-[[3-aminopropyl(methyl)sulfonio]methyl]-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-3-olate |
|---|---|
| PubChem CID | 175676806 |
| Molecular Formula | C14H22N6O3S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S,3S,4R,5R)-2-[[3-aminopropyl(methyl)sulfonio]methyl]-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-3-olate |
| SMILES | C[S+](CCCN)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1[O-] |
| InChI | InChI=1S/C14H22N6O3S/c1-24(4-2-3-15)5-8-10(21)11(22)14(23-8)20-7-19-9-12(16)17-6-18-13(9)20/h6-8,10-11,14,22H,2-5,15H2,1H3,(H2,16,17,18)/t8-,10-,11-,14-,24?/m1/s1 |
| InChIKey | UZUYIYVVCUWBOS-LSRJEVITSA-N |
| XLogP | -2.01 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|