C12H10O4 — CID 175701641
(2Z,4E)-3-deuteriooxycarbonyl-5-phenylpenta-2,4-dienoic acid (PubChem CID 175701641) has the molecular formula C12H10O4 and a molecular weight of 219.21 g/mol. Its IUPAC name is (2Z,4E)-3-deuteriooxycarbonyl-5-phenylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-3-deuteriooxycarbonyl-5-phenylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 175701641 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2Z,4E)-3-deuteriooxycarbonyl-5-phenylpenta-2,4-dienoic acid |
| SMILES | [2H]OC(=O)C(=C\C(=O)O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H10O4/c13-11(14)8-10(12(15)16)7-6-9-4-2-1-3-5-9/h1-8H,(H,13,14)(H,15,16)/b7-6+,10-8-/i/hD |
| InChIKey | DTCCVIYSGXONHU-VQXYPEJNSA-N |
| XLogP | 1.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|