C20H13F3N4O4 — CID 175703550
N-[5-(2-formylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2H-oxete-2-carboxamide (PubChem CID 175703550) has the molecular formula C20H13F3N4O4 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-[5-(2-formylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2H-oxete-2-carboxamide.
| Compound Name | N-[5-(2-formylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2H-oxete-2-carboxamide |
|---|---|
| PubChem CID | 175703550 |
| Molecular Formula | C20H13F3N4O4 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[5-(2-formylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2H-oxete-2-carboxamide |
| SMILES | O=Cc1ccccc1-c1nc(NC(=O)C2C=CO2)n(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H13F3N4O4/c21-20(22,23)31-14-7-5-13(6-8-14)27-19(25-18(29)16-9-10-30-16)24-17(26-27)15-4-2-1-3-12(15)11-28/h1-11,16H,(H,24,25,26,29) |
| InChIKey | SEXQWZWXCPGGRF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|