C16H18O2 — CID 175720305
(1-deuterio-2,2-dimethoxy-2-phenylethyl)benzene (PubChem CID 175720305) has the molecular formula C16H18O2 and a molecular weight of 243.32 g/mol. Its IUPAC name is (1-deuterio-2,2-dimethoxy-2-phenylethyl)benzene.
| Compound Name | (1-deuterio-2,2-dimethoxy-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 175720305 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (1-deuterio-2,2-dimethoxy-2-phenylethyl)benzene |
| SMILES | [2H]C(c1ccccc1)C(OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C16H18O2/c1-17-16(18-2,15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12H,13H2,1-2H3/i13D |
| InChIKey | CTLDMRCJDQGAQJ-YSOHJTORSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|