C25H47BKN3O7Si — CID 175723588
potassium;tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]carbamate;acetate (PubChem CID 175723588) has the molecular formula C25H47BKN3O7Si and a molecular weight of 579.66 g/mol. Its IUPAC name is potassium;tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]carbamate;acetate.
| Compound Name | potassium;tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]carbamate;acetate |
|---|---|
| PubChem CID | 175723588 |
| Molecular Formula | C25H47BKN3O7Si |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | potassium;tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]carbamate;acetate |
| SMILES | CC(=O)[O-].CC(C)(C)OC(=O)NCC(Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1)O[Si](C)(C)C(C)(C)C.[K+] |
| InChI | InChI=1S/C23H44BN3O5Si.C2H4O2.K/c1-20(2,3)29-19(28)25-14-18(30-33(11,12)21(4,5)6)16-27-15-17(13-26-27)24-31-22(7,8)23(9,10)32-24;1-2(3)4;/h13,15,18H,14,16H2,1-12H3,(H,25,28);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | DJURRBJVCSHXPY-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|