C14H26N4O4Si — CID 175725659
4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-triethylsilyloxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 175725659) has the molecular formula C14H26N4O4Si and a molecular weight of 342.47 g/mol. Its IUPAC name is 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-triethylsilyloxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-triethylsilyloxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 175725659 |
| Molecular Formula | C14H26N4O4Si |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-triethylsilyloxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | CC[Si](CC)(CC)[C@]1(n2cnc(N)nc2=O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H26N4O4Si/c1-4-23(5-2,6-3)14(7-10(20)11(8-19)22-14)18-9-16-12(15)17-13(18)21/h9-11,19-20H,4-8H2,1-3H3,(H2,15,17,21)/t10-,11+,14-/m0/s1 |
| InChIKey | XMCVDQSUZQMWJQ-WDMOLILDSA-N |
| XLogP | 0.06 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|