C22H24F3N5O2 — CID 175730586
2-[4-[6-methoxy-5-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]indazol-2-yl]piperidin-1-yl]acetaldehyde (PubChem CID 175730586) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 2-[4-[6-methoxy-5-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]indazol-2-yl]piperidin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[6-methoxy-5-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]indazol-2-yl]piperidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 175730586 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[4-[6-methoxy-5-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]indazol-2-yl]piperidin-1-yl]acetaldehyde |
| SMILES | COc1cc2nn(C3CCN(CC=O)CC3)cc2cc1NCc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H24F3N5O2/c1-32-20-12-18-15(14-30(28-18)17-5-7-29(8-6-17)9-10-31)11-19(20)26-13-16-3-2-4-21(27-16)22(23,24)25/h2-4,10-12,14,17,26H,5-9,13H2,1H3 |
| InChIKey | YCNXDKMSQBRXQD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|