C10H8F3N3O2 — CID 175737622
1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinane-2,4-dione (PubChem CID 175737622) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 175737622 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinane-2,4-dione |
| SMILES | O=C1NCN(Cc2cc(F)c(F)cc2F)C(=O)N1 |
| InChI | InChI=1S/C10H8F3N3O2/c11-6-2-8(13)7(12)1-5(6)3-16-4-14-9(17)15-10(16)18/h1-2H,3-4H2,(H2,14,15,17,18) |
| InChIKey | NFVZXLITPHGBRZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|