C9H8N4O4S — CID 175751809
5-nitro-2-(1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 175751809) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is 5-nitro-2-(1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 5-nitro-2-(1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 175751809 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-nitro-2-(1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1-c1ccn[nH]1 |
| InChI | InChI=1S/C9H8N4O4S/c10-18(16,17)9-5-6(13(14)15)1-2-7(9)8-3-4-11-12-8/h1-5H,(H,11,12)(H2,10,16,17) |
| InChIKey | TUKXYNBBEZPVQX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|