C7H15NO5 — CID 175753792
(2R,3R,4R,5S)-6-deuterio-6-methyliminohexane-1,2,3,4,5-pentol (PubChem CID 175753792) has the molecular formula C7H15NO5 and a molecular weight of 194.21 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-deuterio-6-methyliminohexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-deuterio-6-methyliminohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 175753792 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (2R,3R,4R,5S)-6-deuterio-6-methyliminohexane-1,2,3,4,5-pentol |
| SMILES | [2H]/C(=N\C)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h2,4-7,9-13H,3H2,1H3/b8-2+/t4-,5+,6+,7+/m0/s1/i2D |
| InChIKey | RKMBAGSNCOGHAE-VKTRVLMPSA-N |
| XLogP | -2.88 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|