C23H28N8 — CID 175757569
4-(1H-indazol-5-yl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrimidine-2,4-diamine (PubChem CID 175757569) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-(1H-indazol-5-yl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(1H-indazol-5-yl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175757569 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 4-(1H-indazol-5-yl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrimidine-2,4-diamine |
| SMILES | CC1=CNC(Nc2ccc(N3CCN(C)CC3)cc2)=NC1(N)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C23H28N8/c1-16-14-25-22(28-23(16,24)18-3-8-21-17(13-18)15-26-29-21)27-19-4-6-20(7-5-19)31-11-9-30(2)10-12-31/h3-8,13-15H,9-12,24H2,1-2H3,(H,26,29)(H2,25,27,28) |
| InChIKey | COZOKWIVJUWAKZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|