C16H34N8O6 — CID 175773710
(2S)-4-amino-2-[[(2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-2-amino-4-hydrazinylbutanoyl]amino]-3-hydroxybutanoyl]amino]butanoyl]amino]butanoic acid (PubChem CID 175773710) has the molecular formula C16H34N8O6 and a molecular weight of 434.50 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-2-amino-4-hydrazinylbutanoyl]amino]-3-hydroxybutanoyl]amino]butanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-2-amino-4-hydrazinylbutanoyl]amino]-3-hydroxybutanoyl]amino]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175773710 |
| Molecular Formula | C16H34N8O6 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | (2S)-4-amino-2-[[(2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-2-amino-4-hydrazinylbutanoyl]amino]-3-hydroxybutanoyl]amino]butanoyl]amino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCNN)C(=O)N[C@@H](CCN)C(=O)N[C@@H](CCN)C(=O)O |
| InChI | InChI=1S/C16H34N8O6/c1-8(25)12(24-13(26)9(19)4-7-21-20)15(28)22-10(2-5-17)14(27)23-11(3-6-18)16(29)30/h8-12,21,25H,2-7,17-20H2,1H3,(H,22,28)(H,23,27)(H,24,26)(H,29,30)/t8-,9+,10+,11+,12+/m1/s1 |
| InChIKey | DTQHJLMQYHFXEP-DGORSVRFSA-N |
| XLogP | -5.22 |
| TPSA | 260.94 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|