C8H12N2O2S — CID 175778642
tert-butyl N-(4-deuterio-1,3-thiazol-2-yl)carbamate (PubChem CID 175778642) has the molecular formula C8H12N2O2S and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl N-(4-deuterio-1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-deuterio-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 175778642 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | tert-butyl N-(4-deuterio-1,3-thiazol-2-yl)carbamate |
| SMILES | [2H]c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C8H12N2O2S/c1-8(2,3)12-7(11)10-6-9-4-5-13-6/h4-5H,1-3H3,(H,9,10,11)/i4D |
| InChIKey | NCJXQSNROJRSSL-QYKNYGDISA-N |
| XLogP | 2.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |