About 6-arsohexan-2-amine
6-arsohexan-2-amine (PubChem CID 175792340) has the molecular formula C6H14AsNO2
and a molecular weight of 207.10 g/mol. Its IUPAC name is 6-arsohexan-2-amine.
Molecular Properties
| Compound Name | 6-arsohexan-2-amine |
| PubChem CID | 175792340 |
| Molecular Formula | C6H14AsNO2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 6-arsohexan-2-amine |
| SMILES | CC(N)CCCC[As](=O)=O |
| InChI | InChI=1S/C6H14AsNO2/c1-6(8)4-2-3-5-7(9)10/h6H,2-5,8H2,1H3 |
| InChIKey | APHUAFMMJCXYLO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-arsohexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-arsohexan-2-amine?
The IUPAC name of 6-arsohexan-2-amine (CID 175792340) is 6-arsohexan-2-amine.
What is the SMILES notation for 6-arsohexan-2-amine?
The canonical SMILES for 6-arsohexan-2-amine is CC(N)CCCC[As](=O)=O.
What is the InChIKey of 6-arsohexan-2-amine?
The InChIKey is APHUAFMMJCXYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14AsNO2/c1-6(8)4-2-3-5-7(9)10/h6H,2-5,8H2,1H3.
What are the key properties of 6-arsohexan-2-amine?
6-arsohexan-2-amine has a molecular weight of 207.10 g/mol, XLogP of 0.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-arsohexan-2-amine is sourced from PubChem (CID 175792340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).