C21H28N2O6S — CID 175802956
butyl 2-[3-methoxy-3-oxo-2-(phenylmethoxycarbonylamino)prop-1-enyl]thiomorpholine-4-carboxylate (PubChem CID 175802956) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is butyl 2-[3-methoxy-3-oxo-2-(phenylmethoxycarbonylamino)prop-1-enyl]thiomorpholine-4-carboxylate.
| Compound Name | butyl 2-[3-methoxy-3-oxo-2-(phenylmethoxycarbonylamino)prop-1-enyl]thiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 175802956 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | butyl 2-[3-methoxy-3-oxo-2-(phenylmethoxycarbonylamino)prop-1-enyl]thiomorpholine-4-carboxylate |
| SMILES | CCCCOC(=O)N1CCSC(C=C(NC(=O)OCc2ccccc2)C(=O)OC)C1 |
| InChI | InChI=1S/C21H28N2O6S/c1-3-4-11-28-21(26)23-10-12-30-17(14-23)13-18(19(24)27-2)22-20(25)29-15-16-8-6-5-7-9-16/h5-9,13,17H,3-4,10-12,14-15H2,1-2H3,(H,22,25) |
| InChIKey | WFJXYGAVRHRUKF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|