C18H15ClFNO2 — CID 175819147
(1S,5R)-3-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 175819147) has the molecular formula C18H15ClFNO2 and a molecular weight of 331.77 g/mol. Its IUPAC name is (1S,5R)-3-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 175819147 |
| Molecular Formula | C18H15ClFNO2 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (1S,5R)-3-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | Fc1ccc([C@]23C[C@H]2CN(c2ccc4c(c2)OCO4)C3)c(Cl)c1 |
| InChI | InChI=1S/C18H15ClFNO2/c19-15-5-12(20)1-3-14(15)18-7-11(18)8-21(9-18)13-2-4-16-17(6-13)23-10-22-16/h1-6,11H,7-10H2/t11-,18-/m0/s1 |
| InChIKey | DGQWAUJHFTZPPL-VOJFVSQTSA-N |
| XLogP | 3.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|