C19H16ClFN2O2S — CID 155790779
N-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane-3-carbothioamide (PubChem CID 155790779) has the molecular formula C19H16ClFN2O2S and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane-3-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane-3-carbothioamide |
|---|---|
| PubChem CID | 155790779 |
| Molecular Formula | C19H16ClFN2O2S |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane-3-carbothioamide |
| SMILES | Fc1ccc(C23CC2CN(C(=S)Nc2ccc4c(c2)OCO4)C3)c(Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O2S/c20-15-5-12(21)1-3-14(15)19-7-11(19)8-23(9-19)18(26)22-13-2-4-16-17(6-13)25-10-24-16/h1-6,11H,7-10H2,(H,22,26) |
| InChIKey | GFORITHOHKJZBZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|