C13H27BBrClN2O2 — CID 175835314
N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-amine;hydrochloride (PubChem CID 175835314) has the molecular formula C13H27BBrClN2O2 and a molecular weight of 369.54 g/mol. Its IUPAC name is N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-amine;hydrochloride.
| Compound Name | N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 175835314 |
| Molecular Formula | C13H27BBrClN2O2 |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-amine;hydrochloride |
| SMILES | CC1(C)OB(C2CCNC(NCCBr)C2)OC1(C)C.Cl |
| InChI | InChI=1S/C13H26BBrN2O2.ClH/c1-12(2)13(3,4)19-14(18-12)10-5-7-16-11(9-10)17-8-6-15;/h10-11,16-17H,5-9H2,1-4H3;1H |
| InChIKey | PFMFNKOXOLNNTJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|