C11H17N5O8S2 — CID 175844314
[(2S,5R)-2-[[2-cyanoethyl(methyl)sulfamoyl]-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844314) has the molecular formula C11H17N5O8S2 and a molecular weight of 411.42 g/mol. Its IUPAC name is [(2S,5R)-2-[[2-cyanoethyl(methyl)sulfamoyl]-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[2-cyanoethyl(methyl)sulfamoyl]-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844314 |
| Molecular Formula | C11H17N5O8S2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [(2S,5R)-2-[[2-cyanoethyl(methyl)sulfamoyl]-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN(CCC#N)S(=O)(=O)N(C=O)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H17N5O8S2/c1-13(6-2-5-12)25(19,20)15(8-17)10-4-3-9-7-14(10)11(18)16(9)24-26(21,22)23/h8-10H,2-4,6-7H2,1H3,(H,21,22,23)/t9-,10+/m1/s1 |
| InChIKey | NOFNUFVHQMDZCK-ZJUUUORDSA-N |
| XLogP | -1.50 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|